(Z)-1-[2-(Tri-o-tolylstannyl)vinyl]-1-cyclopentanol (1) was synthesized by the additive reaction of 1-ethynylcyclopentanol with tri-o-tolyltin hydride. One or two of the o-tolyl groups of compound 1 was substituted by I, Br or Cl to yield derivatives of the type CH2(CH2)3CH(OH)CH=CHSn(o-tol)3-nXn [n = 1, X = I (2), Br (3), Cl (4); n = 2, X = Br (5)]. The compounds 1-5 were characterized by elemental analysis, 1H NMR and FT-IR spectroscopy. The crystal and molecular structures of 1 and 2 have been determined by single crystal X-ray diffraction analysis. The Sn atom in 1exhibits a tetrahedral geometry distorted towards trigonal bipyramid, due to a weak intramolecular interaction between Sn and hydroxyl O atoms [2.813(4) A], while the Sn atom in 2 adopts a trigonal bipyramidal geometry with a significant Sn(1) O(1) interaction [2.553(4) A].
JavaScript jest wyłączony w Twojej przeglądarce internetowej. Włącz go, a następnie odśwież stronę, aby móc w pełni z niej korzystać.